Difference between revisions of "CPD1F-135"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-Methylcytosine-DNA == * common-name: ** a 5-methylcytosine in dna == Reaction(s) known to consume the compound == == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c * in...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-Methylcytosine-DNA ==
+
== Metabolite DMPBQ ==
 
* common-name:
 
* common-name:
** a 5-methylcytosine in dna
+
** 2,3-dimethyl-6-phytyl-1,4-benzoquinol
 +
* smiles:
 +
** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c
 +
* inchi-key:
 +
** sufzkubnovdjrr-wgeodtkdsa-n
 +
* molecular-weight:
 +
** 416.686
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
+
* [[RXN-2542]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5-methylcytosine in dna}}
+
{{#set: common-name=2,3-dimethyl-6-phytyl-1,4-benzoquinol}}
 +
{{#set: inchi-key=inchikey=sufzkubnovdjrr-wgeodtkdsa-n}}
 +
{{#set: molecular-weight=416.686}}

Revision as of 14:57, 5 January 2021

Metabolite DMPBQ

  • common-name:
    • 2,3-dimethyl-6-phytyl-1,4-benzoquinol
  • smiles:
    • cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c
  • inchi-key:
    • sufzkubnovdjrr-wgeodtkdsa-n
  • molecular-weight:
    • 416.686

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality