Difference between revisions of "CPD1F-135"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c * in...") |
(Created page with "Category:metabolite == Metabolite App-his-tRNAs == * common-name: ** 5'-(5'-diphosphoadenosine)-ribonucleotide-[trnahis] == Reaction(s) known to consume the compound == *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite App-his-tRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** 5'-(5'-diphosphoadenosine)-ribonucleotide-[trnahis] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12504]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12503]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5'-(5'-diphosphoadenosine)-ribonucleotide-[trnahis]}} |
− | |||
− |
Revision as of 15:28, 5 January 2021
Contents
Metabolite App-his-tRNAs
- common-name:
- 5'-(5'-diphosphoadenosine)-ribonucleotide-[trnahis]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "5'-(5'-diphosphoadenosine)-ribonucleotide-[trnahis" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.