Difference between revisions of "CPD1F-136"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14926 == * common-name: ** phytenal * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o * inchi-key: ** rafzysuicbqabu-pyddkjgssa-n * mol...") |
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE == * common-name: ** 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine * smiles: ** c(nc=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(nc=o)c(=[n+])nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pmcogcvkoaozqm-xvfcmesisa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 312.196 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[AIRS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[FGAMSYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pmcogcvkoaozqm-xvfcmesisa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=312.196}} |
Revision as of 11:13, 15 January 2021
Contents
Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE
- common-name:
- 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine
- smiles:
- c(nc=o)c(=[n+])nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
- inchi-key:
- pmcogcvkoaozqm-xvfcmesisa-m
- molecular-weight:
- 312.196
