Difference between revisions of "CPD1F-136"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10254 == * common-name: ** (9z,12z)-hexadeca-9,12-dienoyl-coa * smiles: ** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
(Created page with "Category:metabolite == Metabolite CPD1F-136 == * common-name: ** ent-7α-hydroxykaur-16-en-19-oate * smiles: ** c=c1(c4(cc[ch]3(c(c1)(c(o)c[ch]2(c(c([o-])=o)(c)cccc(c...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10254 ==
+
== Metabolite CPD1F-136 ==
 
* common-name:
 
* common-name:
** (9z,12z)-hexadeca-9,12-dienoyl-coa
+
** ent-7α-hydroxykaur-16-en-19-oate
 
* smiles:
 
* smiles:
** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c=c1(c4(cc[ch]3(c(c1)(c(o)c[ch]2(c(c([o-])=o)(c)cccc(c)23))c4)))
 
* inchi-key:
 
* inchi-key:
** cqxsjfxwargobe-pcrjdaltsa-j
+
** kmlxvexjzstmbv-ydiyeosvsa-m
 
* molecular-weight:
 
* molecular-weight:
** 997.883
+
** 317.447
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1F-160]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9616]]
+
* [[1.14.13.79-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(9z,12z)-hexadeca-9,12-dienoyl-coa}}
+
{{#set: common-name=ent-7α-hydroxykaur-16-en-19-oate}}
{{#set: inchi-key=inchikey=cqxsjfxwargobe-pcrjdaltsa-j}}
+
{{#set: inchi-key=inchikey=kmlxvexjzstmbv-ydiyeosvsa-m}}
{{#set: molecular-weight=997.883}}
+
{{#set: molecular-weight=317.447}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD1F-136

  • common-name:
    • ent-7α-hydroxykaur-16-en-19-oate
  • smiles:
    • c=c1(c4(cc[ch]3(c(c1)(c(o)c[ch]2(c(c([o-])=o)(c)cccc(c)23))c4)))
  • inchi-key:
    • kmlxvexjzstmbv-ydiyeosvsa-m
  • molecular-weight:
    • 317.447

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality