Difference between revisions of "CPD1F-136"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * smiles: ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** ovboqva...") |
(Created page with "Category:metabolite == Metabolite CPD1F-136 == * common-name: ** ent-7α-hydroxykaur-16-en-19-oate * smiles: ** c=c1(c4(cc[ch]3(c(c1)(c(o)c[ch]2(c(c([o-])=o)(c)cccc(c...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD1F-136 == |
* common-name: | * common-name: | ||
− | ** | + | ** ent-7α-hydroxykaur-16-en-19-oate |
* smiles: | * smiles: | ||
− | ** | + | ** c=c1(c4(cc[ch]3(c(c1)(c(o)c[ch]2(c(c([o-])=o)(c)cccc(c)23))c4))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** kmlxvexjzstmbv-ydiyeosvsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 317.447 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN1F-160]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[1. | + | * [[1.14.13.79-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ent-7α-hydroxykaur-16-en-19-oate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kmlxvexjzstmbv-ydiyeosvsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=317.447}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD1F-136
- common-name:
- ent-7α-hydroxykaur-16-en-19-oate
- smiles:
- c=c1(c4(cc[ch]3(c(c1)(c(o)c[ch]2(c(c([o-])=o)(c)cccc(c)23))c4)))
- inchi-key:
- kmlxvexjzstmbv-ydiyeosvsa-m
- molecular-weight:
- 317.447