Difference between revisions of "CPD1F-139"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TMP == * common-name: ** dtmp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2)) * inchi-key: ** gyozywvxfndglu-xlpzgreqs...") |
(Created page with "Category:metabolite == Metabolite CPD1F-139 == * common-name: ** gibberellin a1 * smiles: ** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1F-139 == |
* common-name: | * common-name: | ||
| − | ** | + | ** gibberellin a1 |
* smiles: | * smiles: | ||
| − | ** | + | ** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc(o)2)([ch](cc3)4)5)(c)))c([o-])=o))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jljlrlwoemwyqk-sntjwbgvsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 347.387 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-115]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=gibberellin a1}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jljlrlwoemwyqk-sntjwbgvsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=347.387}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD1F-139
- common-name:
- gibberellin a1
- smiles:
- c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))
- inchi-key:
- jljlrlwoemwyqk-sntjwbgvsa-m
- molecular-weight:
- 347.387
