Difference between revisions of "CPD1F-139"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TMP == * common-name: ** dtmp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2)) * inchi-key: ** gyozywvxfndglu-xlpzgreqs...") |
(Created page with "Category:metabolite == Metabolite 1-stearidonoyl-L-Phosphatidate == * common-name: ** a 1-stearidonoyl 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-stearidonoyl-L-Phosphatidate == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 1-stearidonoyl 2-acyl-sn-glycerol 3-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-16070]] | |
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 1-stearidonoyl 2-acyl-sn-glycerol 3-phosphate}} |
| − | |||
| − | |||
Revision as of 18:53, 14 January 2021
Contents
Metabolite 1-stearidonoyl-L-Phosphatidate
- common-name:
- a 1-stearidonoyl 2-acyl-sn-glycerol 3-phosphate
