Difference between revisions of "CPD1F-140"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INOSINE == * common-name: ** inosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** ugqmrvrmyyaskq-kqynxxcusa...") |
(Created page with "Category:metabolite == Metabolite CPD1F-140 == * common-name: ** gibberellin a20 * smiles: ** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc2)([ch](cc3)4)5)(c)))c([o-])=o))) *...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1F-140 == |
* common-name: | * common-name: | ||
| − | ** | + | ** gibberellin a20 |
* smiles: | * smiles: | ||
| − | ** c(o)c1( | + | ** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc2)([ch](cc3)4)5)(c)))c([o-])=o))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oxfpycsnyofuch-aodvqfrnsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 331.388 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-113]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=gibberellin a20}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oxfpycsnyofuch-aodvqfrnsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=331.388}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD1F-140
- common-name:
- gibberellin a20
- smiles:
- c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc2)([ch](cc3)4)5)(c)))c([o-])=o)))
- inchi-key:
- oxfpycsnyofuch-aodvqfrnsa-m
- molecular-weight:
- 331.388
