Difference between revisions of "CPD1F-2"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-SELENOCYSTEINE == * common-name: ** l-selenocysteine * smiles: ** c([se])c([n+])c([o-])=o * inchi-key: ** zkzbpngneqajsx-reohclbhsa-n *...") |
(Created page with "Category:metabolite == Metabolite INOSITOL-1-4-5-TRISPHOSPHATE == * common-name: ** d-myo-inositol (1,4,5)-trisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite INOSITOL-1-4-5-TRISPHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** d-myo-inositol (1,4,5)-trisphosphate |
* smiles: | * smiles: | ||
− | ** c([ | + | ** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mmwciqzxvozegg-xjtpdsdzsa-h |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 414.049 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.1.127-RXN]] |
− | + | * [[2.7.1.151-RXN]] | |
− | * [[RXN | + | * [[3.1.3.56-RXN]] |
− | * [[ | + | * [[RXN-10948]] |
− | * [[ | + | * [[RXN-13197]] |
− | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[3.1.4.11-RXN]] |
+ | * [[RXN-10948]] | ||
+ | * [[RXN-13197]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-myo-inositol (1,4,5)-trisphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mmwciqzxvozegg-xjtpdsdzsa-h}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=414.049}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite INOSITOL-1-4-5-TRISPHOSPHATE
- common-name:
- d-myo-inositol (1,4,5)-trisphosphate
- smiles:
- c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
- inchi-key:
- mmwciqzxvozegg-xjtpdsdzsa-h
- molecular-weight:
- 414.049