Difference between revisions of "CPD1F-2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17365 == * common-name: ** (4z,7z,10z,13z,16z)-docosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)...")
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17365 ==
+
== Metabolite CPD1F-2 ==
 
* common-name:
 
* common-name:
** (4z,7z,10z,13z,16z)-docosapentaenoyl-coa
+
** (-)-methyl jasmonate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccc=ccc1(c(=o)ccc1cc(oc)=o)
 
* inchi-key:
 
* inchi-key:
** qkbtyzdpvnterq-uwvcyphhsa-j
+
** gewdntwnsazudx-wqmvxfaesa-n
 
* molecular-weight:
 
* molecular-weight:
** 1075.997
+
** 224.299
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10767]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17116]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4z,7z,10z,13z,16z)-docosapentaenoyl-coa}}
+
{{#set: common-name=(-)-methyl jasmonate}}
{{#set: inchi-key=inchikey=qkbtyzdpvnterq-uwvcyphhsa-j}}
+
{{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}}
{{#set: molecular-weight=1075.997}}
+
{{#set: molecular-weight=224.299}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD1F-2

  • common-name:
    • (-)-methyl jasmonate
  • smiles:
    • ccc=ccc1(c(=o)ccc1cc(oc)=o)
  • inchi-key:
    • gewdntwnsazudx-wqmvxfaesa-n
  • molecular-weight:
    • 224.299

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality