Difference between revisions of "CPD1F-2"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CRPB-all-trans-Retinal == * common-name: ** an all-trans retinal-[cellular-retinol-binding-protein] == Reaction(s) known to consume the c...") |
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1F-2 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (-)-methyl jasmonate |
| + | * smiles: | ||
| + | ** ccc=ccc1(c(=o)ccc1cc(oc)=o) | ||
| + | * inchi-key: | ||
| + | ** gewdntwnsazudx-wqmvxfaesa-n | ||
| + | * molecular-weight: | ||
| + | ** 224.299 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10767]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(-)-methyl jasmonate}} |
| + | {{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}} | ||
| + | {{#set: molecular-weight=224.299}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD1F-2
- common-name:
- (-)-methyl jasmonate
- smiles:
- ccc=ccc1(c(=o)ccc1cc(oc)=o)
- inchi-key:
- gewdntwnsazudx-wqmvxfaesa-n
- molecular-weight:
- 224.299
