Difference between revisions of "CPD1F-2"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19194 == * transcription-direction: ** positive * right-end-position: ** 78523 * left-end-position: ** 44730 * centisome-position: ** 19.375715...") |
(Created page with "Category:metabolite == Metabolite CPD-206 == * common-name: ** phytanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-206 == |
| − | * | + | * common-name: |
| − | ** | + | ** phytanoyl-coa |
| − | + | * smiles: | |
| − | * | + | ** cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o |
| − | + | * inchi-key: | |
| − | ** | + | ** nrjqghhzmsouen-hhvnvsiesa-j |
| − | + | * molecular-weight: | |
| − | + | ** 1058.022 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[1.14.11.18-RXN]] | |
| − | = | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN66-482]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=phytanoyl-coa}} | |
| − | + | {{#set: inchi-key=inchikey=nrjqghhzmsouen-hhvnvsiesa-j}} | |
| − | * | + | {{#set: molecular-weight=1058.022}} |
| − | |||
| − | ** | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-206
- common-name:
- phytanoyl-coa
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- nrjqghhzmsouen-hhvnvsiesa-j
- molecular-weight:
- 1058.022
