Difference between revisions of "CPD1F-2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17365 == * common-name: ** (4z,7z,10z,13z,16z)-docosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)...")
(Created page with "Category:metabolite == Metabolite 3-Prime-Phosphate-Terminated-RNAs == * common-name: ** an [rna]-3'-ribonucleoside-3'-phosphate == Reaction(s) known to consume the compou...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17365 ==
+
== Metabolite 3-Prime-Phosphate-Terminated-RNAs ==
 
* common-name:
 
* common-name:
** (4z,7z,10z,13z,16z)-docosapentaenoyl-coa
+
** an [rna]-3'-ribonucleoside-3'-phosphate
* smiles:
 
** cccccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** qkbtyzdpvnterq-uwvcyphhsa-j
 
* molecular-weight:
 
** 1075.997
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RNA-3-PHOSPHATE-CYCLASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17116]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4z,7z,10z,13z,16z)-docosapentaenoyl-coa}}
+
{{#set: common-name=an [rna]-3'-ribonucleoside-3'-phosphate}}
{{#set: inchi-key=inchikey=qkbtyzdpvnterq-uwvcyphhsa-j}}
 
{{#set: molecular-weight=1075.997}}
 

Revision as of 15:27, 5 January 2021

Metabolite 3-Prime-Phosphate-Terminated-RNAs

  • common-name:
    • an [rna]-3'-ribonucleoside-3'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [rna]-3'-ribonucleoside-3'-phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.