Difference between revisions of "CPD1F-2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8080 == * common-name: ** 1-18:2-2-16:3-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
(Created page with "Category:metabolite == Metabolite CRPB-all-trans-Retinal == * common-name: ** an all-trans retinal-[cellular-retinol-binding-protein] == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8080 ==
+
== Metabolite CRPB-all-trans-Retinal ==
 
* common-name:
 
* common-name:
** 1-18:2-2-16:3-monogalactosyldiacylglycerol
+
** an all-trans retinal-[cellular-retinol-binding-protein]
* smiles:
 
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
 
* inchi-key:
 
** dvrkgrmgqjlnpc-nidyupdjsa-n
 
* molecular-weight:
 
** 749.036
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8301]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8306]]
+
* [[RXN-12581]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-16:3-monogalactosyldiacylglycerol}}
+
{{#set: common-name=an all-trans retinal-[cellular-retinol-binding-protein]}}
{{#set: inchi-key=inchikey=dvrkgrmgqjlnpc-nidyupdjsa-n}}
 
{{#set: molecular-weight=749.036}}
 

Revision as of 18:55, 14 January 2021

Metabolite CRPB-all-trans-Retinal

  • common-name:
    • an all-trans retinal-[cellular-retinol-binding-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an all-trans retinal-[cellular-retinol-binding-protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.