Difference between revisions of "CPD1F-2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19194 == * transcription-direction: ** positive * right-end-position: ** 78523 * left-end-position: ** 44730 * centisome-position: ** 19.375715...")
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19194 ==
+
== Metabolite CPD1F-2 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (-)-methyl jasmonate
−
* right-end-position:
+
* smiles:
−
** 78523
+
** ccc=ccc1(c(=o)ccc1cc(oc)=o)
−
* left-end-position:
+
* inchi-key:
−
** 44730
+
** gewdntwnsazudx-wqmvxfaesa-n
−
* centisome-position:
+
* molecular-weight:
−
** 19.375715   
+
** 224.299
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10767]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[ARYL-SULFOTRANSFERASE-RXN]]
+
{{#set: common-name=(-)-methyl jasmonate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=224.299}}
−
* [[RXN-10614]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10615]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10777]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10782]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-11058]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-11059]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15587]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15588]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15589]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN6666-9]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6261]]
 
−
** '''10''' reactions found over '''15''' reactions in the full pathway
 
−
* [[PWY-6313]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6398]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY6666-2]]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=78523}}
 
−
{{#set: left-end-position=44730}}
 
−
{{#set: centisome-position=19.375715    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=11}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD1F-2

  • common-name:
    • (-)-methyl jasmonate
  • smiles:
    • ccc=ccc1(c(=o)ccc1cc(oc)=o)
  • inchi-key:
    • gewdntwnsazudx-wqmvxfaesa-n
  • molecular-weight:
    • 224.299

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD1F-2&oldid=137867"