Difference between revisions of "CPD1F-4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19160 == * common-name: ** 3-oxo-(11z)-octadecenoyl-coa * smiles: ** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
(Created page with "Category:metabolite == Metabolite PYRAZINOIC-ACID == * common-name: ** pyrazine-2-carboxylate * smiles: ** c1(n=cc=nc=1c([o-])=o) * inchi-key: ** nipzzxufjpqhnh-uhfffaoysa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19160 ==
+
== Metabolite PYRAZINOIC-ACID ==
 
* common-name:
 
* common-name:
** 3-oxo-(11z)-octadecenoyl-coa
+
** pyrazine-2-carboxylate
 
* smiles:
 
* smiles:
** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c1(n=cc=nc=1c([o-])=o)
 
* inchi-key:
 
* inchi-key:
** ourowzutgfhrje-saiinbspsa-j
+
** nipzzxufjpqhnh-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 123.091
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17787]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17786]]
+
* [[PYRAZIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(11z)-octadecenoyl-coa}}
+
{{#set: common-name=pyrazine-2-carboxylate}}
{{#set: inchi-key=inchikey=ourowzutgfhrje-saiinbspsa-j}}
+
{{#set: inchi-key=inchikey=nipzzxufjpqhnh-uhfffaoysa-m}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=123.091}}

Revision as of 11:20, 15 January 2021

Metabolite PYRAZINOIC-ACID

  • common-name:
    • pyrazine-2-carboxylate
  • smiles:
    • c1(n=cc=nc=1c([o-])=o)
  • inchi-key:
    • nipzzxufjpqhnh-uhfffaoysa-m
  • molecular-weight:
    • 123.091

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality