Difference between revisions of "CPD1F-4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTDPDEHYRHAMREDUCT-RXN DTDPDEHYRHAMREDUCT-RXN] == * direction: ** left-to-right * common-name: ** d...")
(Created page with "Category:metabolite == Metabolite CPD1F-4 == * common-name: ** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(=cc=cc=c(c)...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTDPDEHYRHAMREDUCT-RXN DTDPDEHYRHAMREDUCT-RXN] ==
+
== Metabolite CPD1F-4 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** dtdp-4-dehydrorhamnose reductase
+
** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.1.1.133 ec-1.1.1.133]
+
** cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1)
== Reaction formula ==
+
* inchi-key:
* 1 [[DTDP-DEOH-DEOXY-MANNOSE]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[DTDP-RHAMNOSE]][c] '''+''' 1 [[NADP]][c]
+
** mfdugtooxgorrx-orglzdqcsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ22556]]
+
** 382.542
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[RXN-698]]
* [[DTDPRHAMSYN-PWY]], dTDP-L-rhamnose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=DTDPRHAMSYN-PWY DTDPRHAMSYN-PWY]
+
== Reaction(s) of unknown directionality ==
** '''3''' reactions found over '''4''' reactions in the full pathway
+
{{#set: common-name=(3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=mfdugtooxgorrx-orglzdqcsa-n}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=382.542}}
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21796 21796]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R02777 R02777]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/Q9JV74 Q9JV74]
 
** [http://www.uniprot.org/uniprot/P37760 P37760]
 
** [http://www.uniprot.org/uniprot/Q46769 Q46769]
 
** [http://www.uniprot.org/uniprot/O33664 O33664]
 
** [http://www.uniprot.org/uniprot/O66251 O66251]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=dtdp-4-dehydrorhamnose reductase}}
 
{{#set: ec-number=ec-1.1.1.133}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD1F-4

  • common-name:
    • (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
  • smiles:
    • cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1)
  • inchi-key:
    • mfdugtooxgorrx-orglzdqcsa-n
  • molecular-weight:
    • 382.542

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality