Difference between revisions of "CPD1F-4"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35. RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.] ==...") |
(Created page with "Category:metabolite == Metabolite CPD1F-4 == * common-name: ** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(=cc=cc=c(c)...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD1F-4 == |
| − | * | + | * common-name: |
| − | ** | + | ** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al |
| − | == | + | * smiles: |
| − | + | ** cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1) | |
| − | == | + | * inchi-key: |
| − | == | + | ** mfdugtooxgorrx-orglzdqcsa-n |
| − | + | * molecular-weight: | |
| − | * | + | ** 382.542 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[RXN-698]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=(3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}} |
| − | + | {{#set: inchi-key=inchikey=mfdugtooxgorrx-orglzdqcsa-n}} | |
| − | + | {{#set: molecular-weight=382.542}} | |
| − | |||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD1F-4
- common-name:
- (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
- smiles:
- cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1)
- inchi-key:
- mfdugtooxgorrx-orglzdqcsa-n
- molecular-weight:
- 382.542
