Difference between revisions of "CPD1F-437"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13122 == * common-name: ** 4-deoxy-l-threo-hex-4-enopyranuronate * smiles: ** c(c1(oc(c(c(c=1)o)o)o))([o-])=o * inchi-key: ** iakkjsv...") |
(Created page with "Category:metabolite == Metabolite CPD-13793 == * common-name: ** 3-oxo-24-ethyl-cholest-5-ene * smiles: ** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13793 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxo-24-ethyl-cholest-5-ene |
* smiles: | * smiles: | ||
| − | ** c(c1( | + | ** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kyofijxmvnqyfc-xjzkhkohsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 412.698 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12789]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12789]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-oxo-24-ethyl-cholest-5-ene}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kyofijxmvnqyfc-xjzkhkohsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=412.698}} |
Revision as of 08:30, 15 March 2021
Contents
Metabolite CPD-13793
- common-name:
- 3-oxo-24-ethyl-cholest-5-ene
- smiles:
- ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- kyofijxmvnqyfc-xjzkhkohsa-n
- molecular-weight:
- 412.698
