Difference between revisions of "CPD1F-437"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Membrane-Compartments == * common-name: ** a membrane compartment == Reaction(s) known to consume the compound == * 3.6.4.6-RXN == Re...")
(Created page with "Category:metabolite == Metabolite CPD-11444 == * common-name: ** uroporphyrinogen-i * smiles: ** c(=o)([o-])ccc5(=c4(nc(cc1(nc(=c(cc([o-])=o)c(ccc(=o)[o-])=1)cc2(nc(=c(c(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Membrane-Compartments ==
+
== Metabolite CPD-11444 ==
 
* common-name:
 
* common-name:
** a membrane compartment
+
** uroporphyrinogen-i
 +
* smiles:
 +
** c(=o)([o-])ccc5(=c4(nc(cc1(nc(=c(cc([o-])=o)c(ccc(=o)[o-])=1)cc2(nc(=c(c(ccc(=o)[o-])=2)cc(=o)[o-])cc3(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n3)c4))))=c(cc(=o)[o-])5))
 +
* inchi-key:
 +
** qttnoskslatgqb-uhfffaoysa-f
 +
* molecular-weight:
 +
** 828.742
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.4.6-RXN]]
+
* [[RXN-10642]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.6.4.6-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a membrane compartment}}
+
{{#set: common-name=uroporphyrinogen-i}}
 +
{{#set: inchi-key=inchikey=qttnoskslatgqb-uhfffaoysa-f}}
 +
{{#set: molecular-weight=828.742}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-11444

  • common-name:
    • uroporphyrinogen-i
  • smiles:
    • c(=o)([o-])ccc5(=c4(nc(cc1(nc(=c(cc([o-])=o)c(ccc(=o)[o-])=1)cc2(nc(=c(c(ccc(=o)[o-])=2)cc(=o)[o-])cc3(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n3)c4))))=c(cc(=o)[o-])5))
  • inchi-key:
    • qttnoskslatgqb-uhfffaoysa-f
  • molecular-weight:
    • 828.742

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality