Difference between revisions of "CPD1F-95"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Oxidized-2Fe-2S-Ferredoxins == * common-name: ** an oxidized [2fe-2s] ferredoxin == Reaction(s) known to consume the compound == == React...")
(Created page with "Category:metabolite == Metabolite CPD-476 == * common-name: ** 4-(2-aminophenyl)-2,4-dioxobutanoate * smiles: ** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o * inchi-key: ** cao...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Oxidized-2Fe-2S-Ferredoxins ==
+
== Metabolite CPD-476 ==
 
* common-name:
 
* common-name:
** an oxidized [2fe-2s] ferredoxin
+
** 4-(2-aminophenyl)-2,4-dioxobutanoate
 +
* smiles:
 +
** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o
 +
* inchi-key:
 +
** caovwyzqmpnafj-uhfffaoysa-m
 +
* molecular-weight:
 +
** 206.177
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.6.1.7-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.8.1.6-RXN]]
+
* [[2.6.1.7-RXN]]
* [[RXN-11586]]
 
* [[RXN-14950]]
 
* [[RXN-14957]]
 
* [[RXN-14959]]
 
* [[RXN-17472]]
 
* [[RXN0-949]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an oxidized [2fe-2s] ferredoxin}}
+
{{#set: common-name=4-(2-aminophenyl)-2,4-dioxobutanoate}}
 +
{{#set: inchi-key=inchikey=caovwyzqmpnafj-uhfffaoysa-m}}
 +
{{#set: molecular-weight=206.177}}

Revision as of 11:14, 15 January 2021

Metabolite CPD-476

  • common-name:
    • 4-(2-aminophenyl)-2,4-dioxobutanoate
  • smiles:
    • c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o
  • inchi-key:
    • caovwyzqmpnafj-uhfffaoysa-m
  • molecular-weight:
    • 206.177

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality