Difference between revisions of "CPD1F-95"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-476 == * common-name: ** 4-(2-aminophenyl)-2,4-dioxobutanoate * smiles: ** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o * inchi-key: ** cao...") |
(Created page with "Category:metabolite == Metabolite PROTEIN-L-BETA-ISOASPARTATES == * common-name: ** a [protein]-l-β-isoaspartate == Reaction(s) known to consume the compound == * 2...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PROTEIN-L-BETA-ISOASPARTATES == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein]-l-β-isoaspartate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[2. | + | * [[2.1.1.77-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-β-isoaspartate}} |
| − | |||
| − | |||
Revision as of 08:26, 15 March 2021
Contents
Metabolite PROTEIN-L-BETA-ISOASPARTATES
- common-name:
- a [protein]-l-β-isoaspartate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-β-isoaspartate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
