Difference between revisions of "CPD1G-0"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3945 == * common-name: ** (22α)-hydroxy-campest-4-en-3-one * smiles: ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c...") |
(Created page with "Category:metabolite == Metabolite CPD1G-0 == * common-name: ** 1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol * smiles: ** c(o)c2(c(c(c([n+])c(oc1(c(o)c(o)c(...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1G-0 == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** 1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c2(c(c(c([n+])c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hepuigaczyvucd-lfikjohqsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 342.322 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN1G-121]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hepuigaczyvucd-lfikjohqsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=342.322}} |
Latest revision as of 11:10, 18 March 2021
Contents
Metabolite CPD1G-0
- common-name:
- 1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol
- smiles:
- c(o)c2(c(c(c([n+])c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
- inchi-key:
- hepuigaczyvucd-lfikjohqsa-o
- molecular-weight:
- 342.322
