Difference between revisions of "CPD1G-0"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07328 == * transcription-direction: ** negative * right-end-position: ** 43773 * left-end-position: ** 20924 * centisome-position: ** 30.247921...")
(Created page with "Category:metabolite == Metabolite CPD1G-0 == * common-name: ** 1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol * smiles: ** c(o)c2(c(c(c([n+])c(oc1(c(o)c(o)c(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ07328 ==
+
== Metabolite CPD1G-0 ==
* transcription-direction:
+
* common-name:
** negative
+
** 1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol
* right-end-position:
+
* smiles:
** 43773
+
** c(o)c2(c(c(c([n+])c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
* left-end-position:
+
* inchi-key:
** 20924
+
** hepuigaczyvucd-lfikjohqsa-o
* centisome-position:
+
* molecular-weight:
** 30.247921   
+
** 342.322
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN1G-121]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.1.6.12-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=hepuigaczyvucd-lfikjohqsa-o}}
* [[ARYLSULFAT-RXN]]
+
{{#set: molecular-weight=342.322}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=43773}}
 
{{#set: left-end-position=20924}}
 
{{#set: centisome-position=30.247921    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Latest revision as of 11:10, 18 March 2021

Metabolite CPD1G-0

  • common-name:
    • 1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol
  • smiles:
    • c(o)c2(c(c(c([n+])c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
  • inchi-key:
    • hepuigaczyvucd-lfikjohqsa-o
  • molecular-weight:
    • 342.322

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality