Difference between revisions of "CPD1G-120"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17539 == * common-name: ** dapdiamide a * smiles: ** cc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** jagleobxishnnm-br...") |
(Created page with "Category:metabolite == Metabolite CPD1G-120 == * common-name: ** deacetylmycothiol * smiles: ** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) * inchi-k...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1G-120 == |
* common-name: | * common-name: | ||
| − | ** | + | ** deacetylmycothiol |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zgxscmbzzvxwgf-bseffjthsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 445.461 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1G-121]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=deacetylmycothiol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zgxscmbzzvxwgf-bseffjthsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=445.461}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD1G-120
- common-name:
- deacetylmycothiol
- smiles:
- c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
- inchi-key:
- zgxscmbzzvxwgf-bseffjthsa-o
- molecular-weight:
- 445.461
