Difference between revisions of "CPD1G-120"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAPDHSYNEC-RXN GAPDHSYNEC-RXN] == * direction: ** reversible * common-name: ** glyceraldehyde-3-pho...")
(Created page with "Category:metabolite == Metabolite CPD1G-120 == * common-name: ** deacetylmycothiol * smiles: ** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) * inchi-k...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAPDHSYNEC-RXN GAPDHSYNEC-RXN] ==
+
== Metabolite CPD1G-120 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** glyceraldehyde-3-phosphate dehydrogenase (nad(p)+) (phosphorylating)
+
** deacetylmycothiol
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.2.1.59 ec-1.2.1.59]
+
** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[GAP]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[Pi]][c] '''<=>''' 1 [[DPG]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c]
+
** zgxscmbzzvxwgf-bseffjthsa-o
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ00348]]
+
** 445.461
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN1G-121]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=deacetylmycothiol}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=zgxscmbzzvxwgf-bseffjthsa-o}}
−
* LIGAND-RXN:
+
{{#set: molecular-weight=445.461}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R01063 R01063]
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10299 10299]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=glyceraldehyde-3-phosphate dehydrogenase (nad(p)+) (phosphorylating)}}
 
−
{{#set: ec-number=ec-1.2.1.59}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD1G-120

  • common-name:
    • deacetylmycothiol
  • smiles:
    • c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
  • inchi-key:
    • zgxscmbzzvxwgf-bseffjthsa-o
  • molecular-weight:
    • 445.461

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD1G-120&oldid=139464"