Difference between revisions of "CPD1G-120"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYOXI-RXN GLYOXI-RXN] == * direction: ** reversible * common-name: ** glyoxalase i ** lactoylgluta...") |
(Created page with "Category:metabolite == Metabolite CPD1G-120 == * common-name: ** deacetylmycothiol * smiles: ** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) * inchi-k...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD1G-120 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** deacetylmycothiol |
− | * | + | * smiles: |
− | + | ** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) | |
− | ** | + | * inchi-key: |
− | = | + | ** zgxscmbzzvxwgf-bseffjthsa-o |
− | + | * molecular-weight: | |
− | + | ** 445.461 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN1G-121]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=deacetylmycothiol}} | |
− | + | {{#set: inchi-key=inchikey=zgxscmbzzvxwgf-bseffjthsa-o}} | |
− | + | {{#set: molecular-weight=445.461}} | |
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD1G-120
- common-name:
- deacetylmycothiol
- smiles:
- c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
- inchi-key:
- zgxscmbzzvxwgf-bseffjthsa-o
- molecular-weight:
- 445.461