|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYOXI-RXN GLYOXI-RXN] == | + | == Metabolite CPD1G-120 == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** glyoxalase i | + | ** deacetylmycothiol |
| − | ** lactoylglutathione lyase | + | * smiles: |
| − | * ec-number:
| + | ** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) |
| − | ** [http://enzyme.expasy.org/EC/4.4.1.5 ec-4.4.1.5] | + | * inchi-key: |
| − | == Reaction formula == | + | ** zgxscmbzzvxwgf-bseffjthsa-o |
| − | * 1 [[S-LACTOYL-GLUTATHIONE]][c] '''<=>''' 1 [[GLUTATHIONE]][c] '''+''' 1 [[METHYL-GLYOXAL]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 445.461 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ17178]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]] | + | * [[RXN1G-121]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ19492]]
| + | {{#set: common-name=deacetylmycothiol}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=zgxscmbzzvxwgf-bseffjthsa-o}} |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: molecular-weight=445.461}} |
| − | * Gene: [[SJ20171]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ11959]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ02270]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | * Gene: [[SJ13886]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-5386]], methylglyoxal degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5386 PWY-5386]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19072 19072]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02530 R02530]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q04760 Q04760]
| |
| − | ** [http://www.uniprot.org/uniprot/P0AC81 P0AC81]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A0T3 P0A0T3]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A0T2 P0A0T2]
| |
| − | ** [http://www.uniprot.org/uniprot/P44638 P44638]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A1Q2 P0A1Q2]
| |
| − | ** [http://www.uniprot.org/uniprot/P46417 P46417]
| |
| − | ** [http://www.uniprot.org/uniprot/Q42891 Q42891]
| |
| − | ** [http://www.uniprot.org/uniprot/Q55595 Q55595]
| |
| − | ** [http://www.uniprot.org/uniprot/Q09751 Q09751]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9XGF2 Q9XGF2]
| |
| − | ** [http://www.uniprot.org/uniprot/P16635 P16635]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=lactoylglutathione lyase|glyoxalase i}} | |
| − | {{#set: ec-number=ec-4.4.1.5}} | |
| − | {{#set: nb gene associated=6}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
| |
