Difference between revisions of "CPD1G-1345"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17385 == * common-name: ** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=...")
(Created page with "Category:metabolite == Metabolite EIF5A-LYSINE == * common-name: ** an [eif5a-precursor]-lysine == Reaction(s) known to consume the compound == * 2.5.1.46-RXN * RXN-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17385 ==
+
== Metabolite EIF5A-LYSINE ==
 
* common-name:
 
* common-name:
** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** an [eif5a-precursor]-lysine
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** krifzirxaaithr-kwfbmmabsa-j
 
* molecular-weight:
 
** 1102.034
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16134]]
+
* [[2.5.1.46-RXN]]
 +
* [[RXN-13416]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16132]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=an [eif5a-precursor]-lysine}}
{{#set: inchi-key=inchikey=krifzirxaaithr-kwfbmmabsa-j}}
 
{{#set: molecular-weight=1102.034}}
 

Revision as of 14:56, 5 January 2021

Metabolite EIF5A-LYSINE

  • common-name:
    • an [eif5a-precursor]-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [eif5a-precursor]-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.