Difference between revisions of "CPD1G-1354"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12015 == * common-name: ** 6-sulfatoxymelatonin * smiles: ** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2)) * inchi-key: ** qqe...") |
(Created page with "Category:metabolite == Metabolite CPD-18353 == * common-name: ** 1,2-dicis-vaccenoyl-phosphatidate * smiles: ** ccccccc=ccccccccccc(occ(oc(=o)cccccccccc=ccccccc)cop([o-])(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-18353 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1,2-dicis-vaccenoyl-phosphatidate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccc=ccccccccccc(occ(oc(=o)cccccccccc=ccccccc)cop([o-])(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lmyybyhazafvtr-rlsipvdzsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 698.959 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17011]] |
| + | * [[RXN-17015]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1,2-dicis-vaccenoyl-phosphatidate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lmyybyhazafvtr-rlsipvdzsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=698.959}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite CPD-18353
- common-name:
- 1,2-dicis-vaccenoyl-phosphatidate
- smiles:
- ccccccc=ccccccccccc(occ(oc(=o)cccccccccc=ccccccc)cop([o-])(=o)[o-])=o
- inchi-key:
- lmyybyhazafvtr-rlsipvdzsa-l
- molecular-weight:
- 698.959
