Difference between revisions of "CPD1G-768"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10712 == * common-name: ** di-trans, poly-cis-polyprenyl diphosphate (c80) * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite Aliphatic-L-Amino-Acids == * common-name: ** an aliphatic l-amino acid == Reaction(s) known to consume the compound == == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10712 ==
+
== Metabolite Aliphatic-L-Amino-Acids ==
 
* common-name:
 
* common-name:
** di-trans, poly-cis-polyprenyl diphosphate (c80)
+
** an aliphatic l-amino acid
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-]
 
* inchi-key:
 
** tunipipdjadhsr-hiqrjctmsa-k
 
* molecular-weight:
 
** 1264.842
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9969]]
+
* [[AMINOACYLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans, poly-cis-polyprenyl diphosphate (c80)}}
+
{{#set: common-name=an aliphatic l-amino acid}}
{{#set: inchi-key=inchikey=tunipipdjadhsr-hiqrjctmsa-k}}
 
{{#set: molecular-weight=1264.842}}
 

Revision as of 08:24, 15 March 2021

Metabolite Aliphatic-L-Amino-Acids

  • common-name:
    • an aliphatic l-amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality