Difference between revisions of "CPD1G-768"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FRUCTOSE-16-DIPHOSPHATE == * common-name: ** β-d-fructose 1,6-bisphosphate * smiles: ** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([...")
(Created page with "Category:metabolite == Metabolite CPD1G-768 == * common-name: ** 6-o-α-mycolyl-trehalose 6-phosphate * smiles: ** ccccccccccccccccccccccccccc(c(o)cccccccccccccccc2(c...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FRUCTOSE-16-DIPHOSPHATE ==
+
== Metabolite CPD1G-768 ==
 
* common-name:
 
* common-name:
** β-d-fructose 1,6-bisphosphate
+
** 6-o-α-mycolyl-trehalose 6-phosphate
 
* smiles:
 
* smiles:
** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
+
** ccccccccccccccccccccccccccc(c(o)cccccccccccccccc2(cc(ccccccccccc1(cc(cccccccccccccccccc)1))2))c(=o)occ3(oc(c(c(c3o)o)o)oc4(c(c(c(c(o4)cop([o-])(=o)[o-])o)o)o))
 
* inchi-key:
 
* inchi-key:
** rnbgygvwrkecfj-arqdhwqxsa-j
+
** gxobndajnvberi-bgzciimlsa-l
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 1540.305
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.90-RXN]]
+
* [[RXN1G-1435]]
* [[F16ALDOLASE-RXN]]
 
* [[F16BDEPHOS-RXN]]
 
* [[FBA_]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.90-RXN]]
 
* [[6PFRUCTPHOS-RXN]]
 
* [[F16ALDOLASE-RXN]]
 
* [[FBA_]]
 
* [[PFK_]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-fructose 1,6-bisphosphate}}
+
{{#set: common-name=6-o-α-mycolyl-trehalose 6-phosphate}}
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-arqdhwqxsa-j}}
+
{{#set: inchi-key=inchikey=gxobndajnvberi-bgzciimlsa-l}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=1540.305}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD1G-768

  • common-name:
    • 6-o-α-mycolyl-trehalose 6-phosphate
  • smiles:
    • ccccccccccccccccccccccccccc(c(o)cccccccccccccccc2(cc(ccccccccccc1(cc(cccccccccccccccccc)1))2))c(=o)occ3(oc(c(c(c3o)o)o)oc4(c(c(c(c(o4)cop([o-])(=o)[o-])o)o)o))
  • inchi-key:
    • gxobndajnvberi-bgzciimlsa-l
  • molecular-weight:
    • 1540.305

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality