Difference between revisions of "CPD1G-768"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FRUCTOSE-16-DIPHOSPHATE == * common-name: ** β-d-fructose 1,6-bisphosphate * smiles: ** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([...")
(Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FRUCTOSE-16-DIPHOSPHATE ==
+
== Metabolite SIROHYDROCHLORIN ==
 
* common-name:
 
* common-name:
** β-d-fructose 1,6-bisphosphate
+
** sirohydrochlorin
 
* smiles:
 
* smiles:
** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
+
** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
 
* inchi-key:
 
* inchi-key:
** rnbgygvwrkecfj-arqdhwqxsa-j
+
** kwizrxmmfrbuml-ahgfgahvsa-f
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 854.779
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.90-RXN]]
+
* [[4.99.1.3-RXN]]
* [[F16ALDOLASE-RXN]]
+
* [[SIROHEME-FERROCHELAT-RXN]]
* [[F16BDEPHOS-RXN]]
 
* [[FBA_]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.90-RXN]]
+
* [[DIMETHUROPORDEHYDROG-RXN]]
* [[6PFRUCTPHOS-RXN]]
 
* [[F16ALDOLASE-RXN]]
 
* [[FBA_]]
 
* [[PFK_]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-fructose 1,6-bisphosphate}}
+
{{#set: common-name=sirohydrochlorin}}
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-arqdhwqxsa-j}}
+
{{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=854.779}}

Revision as of 13:07, 14 January 2021

Metabolite SIROHYDROCHLORIN

  • common-name:
    • sirohydrochlorin
  • smiles:
    • cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
  • inchi-key:
    • kwizrxmmfrbuml-ahgfgahvsa-f
  • molecular-weight:
    • 854.779

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality