Difference between revisions of "CPD1G-774"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17049 == * common-name: ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))n...")
(Created page with "Category:metabolite == Metabolite 44-DIMETHYL-824-CHOLESTADIENOL == * common-name: ** 4,4-dimethylzymosterol * smiles: ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c)(c)c(o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17049 ==
+
== Metabolite 44-DIMETHYL-824-CHOLESTADIENOL ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
+
** 4,4-dimethylzymosterol
 
* smiles:
 
* smiles:
** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))nc(=o)2)
+
** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c)(c)c(o)ccc(c)1c=2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** vzgsjjjqzptkgr-vxgbxaggsa-n
+
** chgikssznbcndw-qgbojxoesa-n
 
* molecular-weight:
 
* molecular-weight:
** 298.374
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15684]]
+
* [[RXN-13712]]
 +
* [[RXN-13712-44-DIMETHYL-824-CHOLESTADIENOL/NADH/OXYGEN-MOLECULE/PROTON//CPD-4577/NAD/WATER.79.]]
 +
* [[RXN-13712-44-DIMETHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4577/NADP/WATER.81.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-306]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=4,4-dimethylzymosterol}}
{{#set: inchi-key=inchikey=vzgsjjjqzptkgr-vxgbxaggsa-n}}
+
{{#set: inchi-key=inchikey=chgikssznbcndw-qgbojxoesa-n}}
{{#set: molecular-weight=298.374}}
+
{{#set: molecular-weight=412.698}}

Revision as of 08:27, 15 March 2021

Metabolite 44-DIMETHYL-824-CHOLESTADIENOL

  • common-name:
    • 4,4-dimethylzymosterol
  • smiles:
    • cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c)(c)c(o)ccc(c)1c=2ccc(c)34))))
  • inchi-key:
    • chgikssznbcndw-qgbojxoesa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality