Difference between revisions of "CPD3DJ-11366"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite G-protein-coupled-receptors == * common-name: ** a g protein-coupled receptor == Reaction(s) known to consume the compound == * 2.7.11....") |
(Created page with "Category:metabolite == Metabolite THIAMINE-P == * common-name: ** thiamine phosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite THIAMINE-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** thiamine phosphate |
| + | * smiles: | ||
| + | ** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) | ||
| + | * inchi-key: | ||
| + | ** hzsajdvwzrbgif-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 343.317 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-3542]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12610]] |
| + | * [[RXN-12611]] | ||
| + | * [[RXN0-3542]] | ||
| + | * [[THI-P-SYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thiamine phosphate}} |
| + | {{#set: inchi-key=inchikey=hzsajdvwzrbgif-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=343.317}} | ||
Revision as of 11:15, 15 January 2021
Contents
Metabolite THIAMINE-P
- common-name:
- thiamine phosphate
- smiles:
- cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
- inchi-key:
- hzsajdvwzrbgif-uhfffaoysa-m
- molecular-weight:
- 343.317
