Difference between revisions of "CPD3DJ-11366"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13398 == * common-name: ** l-alanyl-l-leucine * smiles: ** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o * inchi-key: ** rdikfprvljlmer-bqbzgakwsa...") |
(Created page with "Category:metabolite == Metabolite CPD3DJ-11366 == * common-name: ** sphingosine 1-phosphate * smiles: ** cccccccccccccc=cc(o)c([n+])cop(=o)([o-])[o-] * inchi-key: ** duysy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD3DJ-11366 == |
* common-name: | * common-name: | ||
| − | ** | + | ** sphingosine 1-phosphate |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cccccccccccccc=cc(o)c([n+])cop(=o)([o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** duysyhssbdvjsm-krwokugfsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 378.468 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN3DJ-11230]] |
| + | * [[RXN3DJ-25]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN3DJ-11417]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sphingosine 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=duysyhssbdvjsm-krwokugfsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=378.468}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD3DJ-11366
- common-name:
- sphingosine 1-phosphate
- smiles:
- cccccccccccccc=cc(o)c([n+])cop(=o)([o-])[o-]
- inchi-key:
- duysyhssbdvjsm-krwokugfsa-m
- molecular-weight:
- 378.468
