Difference between revisions of "CPD3DJ-11366"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-L-Serine == * common-name: ** an n-terminal l-seryl-[protein] == Reaction(s) known to consume the compound == == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-4209 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n6-dimethylallyladenine |
| + | * smiles: | ||
| + | ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) | ||
| + | * inchi-key: | ||
| + | ** hyvabzigrdekcd-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 203.246 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[1.5.99.12-RXN]] | ||
| + | * [[RXN-4315]] | ||
| + | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] | ||
| + | * [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[1.5.99.12-RXN]] |
| + | * [[RXN-4313]] | ||
| + | * [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]] | ||
| + | * [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]] | ||
| + | * [[RXN-4315]] | ||
| + | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] | ||
| + | * [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n6-dimethylallyladenine}} |
| + | {{#set: inchi-key=inchikey=hyvabzigrdekcd-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=203.246}} | ||
Revision as of 14:56, 5 January 2021
Contents
Metabolite CPD-4209
- common-name:
- n6-dimethylallyladenine
- smiles:
- cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
- inchi-key:
- hyvabzigrdekcd-uhfffaoysa-n
- molecular-weight:
- 203.246
Reaction(s) known to consume the compound
- 1.5.99.12-RXN
- RXN-4315
- RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.
- RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.
Reaction(s) known to produce the compound
- 1.5.99.12-RXN
- RXN-4313
- RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.
- RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.
- RXN-4315
- RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.
- RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.
