Difference between revisions of "CPD3DJ-82"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02538 == * transcription-direction: ** positive * right-end-position: ** 59266 * left-end-position: ** 45002 * centisome-position: ** 33.726036...") |
(Created page with "Category:metabolite == Metabolite LL-DIAMINOPIMELATE == * common-name: ** l,l-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezvlhj...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite LL-DIAMINOPIMELATE == |
− | * | + | * common-name: |
− | ** | + | ** l,l-diaminopimelate |
− | * | + | * smiles: |
− | ** | + | ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** gmkmezvlhjarhf-whfbiakzsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 190.199 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[DIAMINOPIMEPIM-RXN]] |
− | == Reaction(s) | + | * [[RXN-7737]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[DIAMINOPIMEPIM-RXN]] |
− | + | * [[RXN-7737]] | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=l,l-diaminopimelate}} |
− | + | {{#set: inchi-key=inchikey=gmkmezvlhjarhf-whfbiakzsa-n}} | |
− | {{#set: | + | {{#set: molecular-weight=190.199}} |
− | |||
− |
Revision as of 20:31, 18 December 2020
Contents
Metabolite LL-DIAMINOPIMELATE
- common-name:
- l,l-diaminopimelate
- smiles:
- c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
- inchi-key:
- gmkmezvlhjarhf-whfbiakzsa-n
- molecular-weight:
- 190.199