|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=7KAPSYN-RXN 7KAPSYN-RXN] == | + | == Metabolite CPD66-21 == |
| − | * direction: | + | * common-name: |
| − | ** left-to-right | + | ** leukotriene-d4 |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.3.1.47 ec-2.3.1.47] | + | ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[CPD-558]][c] '''+''' 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[8-AMINO-7-OXONONANOATE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c]
| + | ** yeeskjgwjfyook-ijhyuljssa-m |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ00855]] | + | ** 495.653 |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[RXN66-336]] |
| − | == Pathway(s) == | + | == Reaction(s) of unknown directionality == |
| − | * [[PWY-6578]], 8-amino-7-oxononanoate biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6578 PWY-6578]
| + | {{#set: common-name=leukotriene-d4}} |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | {{#set: inchi-key=inchikey=yeeskjgwjfyook-ijhyuljssa-m}} |
| − | == Reconstruction information ==
| + | {{#set: molecular-weight=495.653}} |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20712 20712]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03210 R03210]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q58694 Q58694]
| |
| − | ** [http://www.uniprot.org/uniprot/O84782 O84782]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9Z6Y3 Q9Z6Y3]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A4X4 P0A4X4]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9K0U0 Q9K0U0]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PLE6 Q9PLE6]
| |
| − | ** [http://www.uniprot.org/uniprot/P44422 P44422]
| |
| − | ** [http://www.uniprot.org/uniprot/O25320 O25320]
| |
| − | ** [http://www.uniprot.org/uniprot/P53556 P53556]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PIJ3 Q9PIJ3]
| |
| − | ** [http://www.uniprot.org/uniprot/O66875 O66875]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZLN3 Q9ZLN3]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9Z6L6 Q9Z6L6]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JT28 Q9JT28]
| |
| − | ** [http://www.uniprot.org/uniprot/P22806 P22806]
| |
| − | ** [http://www.uniprot.org/uniprot/P45487 P45487]
| |
| − | ** [http://www.uniprot.org/uniprot/P74770 P74770]
| |
| − | ** [http://www.uniprot.org/uniprot/P12998 P12998]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: ec-number=ec-2.3.1.47}} | |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=orthology}} | |
| − | {{#set: reconstruction tool=pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_nannochloropsis_salina|output_pantograph_arabidopsis_thaliana}}
| |
