Difference between revisions of "CPD66-21"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.2-RXN 1.3.7.2-RXN] == * direction: ** left-to-right * common-name: ** 15,16-dihydrobiliverdin...")
(Created page with "Category:metabolite == Metabolite CPD66-21 == * common-name: ** leukotriene-d4 * smiles: ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o * inchi-key: **...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.2-RXN 1.3.7.2-RXN] ==
+
== Metabolite CPD66-21 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 15,16-dihydrobiliverdin:ferredoxin oxidoreductase
+
** leukotriene-d4
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.7.2 ec-1.3.7.2]
+
** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[BILIVERDINE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''=>''' 1 [[1516-DIHYDROBILIVERDIN]][c] '''+''' 2 [[Oxidized-ferredoxins]][c]
+
** yeeskjgwjfyook-ijhyuljssa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03344]]
+
** 495.653
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ04340]]
+
* [[RXN66-336]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=leukotriene-d4}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=yeeskjgwjfyook-ijhyuljssa-m}}
−
* [[PWY-5915]], phycoerythrobilin biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5915 PWY-5915]
+
{{#set: molecular-weight=495.653}}
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7579]], phycourobilin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7579 PWY-7579]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10170 10170]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R05818 R05818]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=15,16-dihydrobiliverdin:ferredoxin oxidoreductase}}
 
−
{{#set: ec-number=ec-1.3.7.2}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD66-21

  • common-name:
    • leukotriene-d4
  • smiles:
    • cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)[n+])c(cccc([o-])=o)o
  • inchi-key:
    • yeeskjgwjfyook-ijhyuljssa-m
  • molecular-weight:
    • 495.653

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD66-21&oldid=138739"