Difference between revisions of "CPD66-39"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17943 == * transcription-direction: ** negative * right-end-position: ** 190632 * left-end-position: ** 180732 * centisome-position: ** 71.17955...") |
(Created page with "Category:metabolite == Metabolite CPD-194 == * common-name: ** 4-nitrophenyl phosphate * smiles: ** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1) * inchi-key: ** xzkihkmte...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-194 == |
| − | * | + | * common-name: |
| − | ** | + | ** 4-nitrophenyl phosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** xzkihkmtemtjqx-uhfffaoysa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 217.074 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | |||
| − | == Reaction(s) | ||
| − | |||
| − | |||
| − | |||
* [[4-NITROPHENYLPHOSPHATASE-RXN]] | * [[4-NITROPHENYLPHOSPHATASE-RXN]] | ||
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=4-nitrophenyl phosphate}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=xzkihkmtemtjqx-uhfffaoysa-l}} |
| − | + | {{#set: molecular-weight=217.074}} | |
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-194
- common-name:
- 4-nitrophenyl phosphate
- smiles:
- c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1)
- inchi-key:
- xzkihkmtemtjqx-uhfffaoysa-l
- molecular-weight:
- 217.074
