Difference between revisions of "CPDMETA-13651"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Odd-Straight-Chain-234-Sat-FALD == * common-name: ** an odd numbered straight chain 2,3,4-saturated fatty aldehyde == Reaction(s) known t...")
(Created page with "Category:metabolite == Metabolite CPD-15436 == * common-name: ** (5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Odd-Straight-Chain-234-Sat-FALD ==
+
== Metabolite CPD-15436 ==
 
* common-name:
 
* common-name:
** an odd numbered straight chain 2,3,4-saturated fatty aldehyde
+
** (5z)-tetradecenoyl-coa
 +
* smiles:
 +
** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** mrvdzohjmltlhj-stfckwfxsa-j
 +
* molecular-weight:
 +
** 971.845
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-476]]
+
* [[RXN-14576]]
 +
* [[RXN-17783]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17782]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an odd numbered straight chain 2,3,4-saturated fatty aldehyde}}
+
{{#set: common-name=(5z)-tetradecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=mrvdzohjmltlhj-stfckwfxsa-j}}
 +
{{#set: molecular-weight=971.845}}

Revision as of 08:26, 15 March 2021

Metabolite CPD-15436

  • common-name:
    • (5z)-tetradecenoyl-coa
  • smiles:
    • ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • mrvdzohjmltlhj-stfckwfxsa-j
  • molecular-weight:
    • 971.845

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality