Difference between revisions of "CPDMETA-13652"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20106 == * transcription-direction: ** negative * right-end-position: ** 1479 * left-end-position: ** 142 * centisome-position: ** 8.706315 ==...")
(Created page with "Category:metabolite == Metabolite CPDMETA-13652 == * common-name: ** raucaffrinoline * smiles: ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6))))) * i...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ20106 ==
+
== Metabolite CPDMETA-13652 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** raucaffrinoline
−
* right-end-position:
+
* smiles:
−
** 1479
+
** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6)))))
−
* left-end-position:
+
* inchi-key:
−
** 142
+
** ximpcxfldskalh-vqhwpedhsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 8.706315   
+
** 352.432
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-12673]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-12701]]
+
{{#set: common-name=raucaffrinoline}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=ximpcxfldskalh-vqhwpedhsa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=352.432}}
−
* [[RXN-12848]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12849]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12850]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17644]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17653]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17654]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17655]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6945]]
 
−
** '''5''' reactions found over '''17''' reactions in the full pathway
 
−
* [[PWY-6946]]
 
−
** '''6''' reactions found over '''22''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=1479}}
 
−
{{#set: left-end-position=142}}
 
−
{{#set: centisome-position=8.706315    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=8}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPDMETA-13652

  • common-name:
    • raucaffrinoline
  • smiles:
    • cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6)))))
  • inchi-key:
    • ximpcxfldskalh-vqhwpedhsa-n
  • molecular-weight:
    • 352.432

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPDMETA-13652&oldid=138007"