Difference between revisions of "CPDMETA-13652"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21215 == * transcription-direction: ** negative * right-end-position: ** 394354 * left-end-position: ** 382280 * centisome-position: ** 63.617165...")
 
(Created page with "Category:metabolite == Metabolite CPDMETA-13652 == * common-name: ** raucaffrinoline * smiles: ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6))))) * i...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21215 ==
+
== Metabolite CPDMETA-13652 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** raucaffrinoline
−
* right-end-position:
+
* smiles:
−
** 394354
+
** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6)))))
−
* left-end-position:
+
* inchi-key:
−
** 382280
+
** ximpcxfldskalh-vqhwpedhsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 63.617165   
+
** 352.432
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-12673]]
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=raucaffrinoline}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ximpcxfldskalh-vqhwpedhsa-n}}
−
* [[ALKAPHOSPHA-RXN]]
+
{{#set: molecular-weight=352.432}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-5822]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8748]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[NAD-BIOSYNTHESIS-II]]
 
−
** '''4''' reactions found over '''3''' reactions in the full pathway
 
−
* [[NADPHOS-DEPHOS-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5083]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-5491]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=394354}}
 
−
{{#set: left-end-position=382280}}
 
−
{{#set: centisome-position=63.617165    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPDMETA-13652

  • common-name:
    • raucaffrinoline
  • smiles:
    • cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6)))))
  • inchi-key:
    • ximpcxfldskalh-vqhwpedhsa-n
  • molecular-weight:
    • 352.432

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPDMETA-13652&oldid=138007"