Difference between revisions of "CPDMETA-13652"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13398 == * common-name: ** l-alanyl-l-leucine * smiles: ** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o * inchi-key: ** rdikfprvljlmer-bqbzgakwsa...")
(Created page with "Category:metabolite == Metabolite N-acyl-sphingosylphosphorylcholine == * common-name: ** an n-acyl-sphingosylphosphorylcholine == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13398 ==
+
== Metabolite N-acyl-sphingosylphosphorylcholine ==
 
* common-name:
 
* common-name:
** l-alanyl-l-leucine
+
** an n-acyl-sphingosylphosphorylcholine
* smiles:
 
** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o
 
* inchi-key:
 
** rdikfprvljlmer-bqbzgakwsa-n
 
* molecular-weight:
 
** 202.253
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6979]]
+
* [[RXN-15212]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15211]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-alanyl-l-leucine}}
+
{{#set: common-name=an n-acyl-sphingosylphosphorylcholine}}
{{#set: inchi-key=inchikey=rdikfprvljlmer-bqbzgakwsa-n}}
 
{{#set: molecular-weight=202.253}}
 

Revision as of 15:27, 5 January 2021

Metabolite N-acyl-sphingosylphosphorylcholine

  • common-name:
    • an n-acyl-sphingosylphosphorylcholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality