Difference between revisions of "CPDQT-27"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHYTOL == * common-name: ** phytol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cco * inchi-key: ** botwfxyspfmfnr-pyddkjgssa-n * molecular-we...") |
(Created page with "Category:metabolite == Metabolite CPDQT-27 == * common-name: ** 6-(methylthio)-2-oxohexanoate * smiles: ** csccccc(=o)c([o-])=o * inchi-key: ** grugzhaoxopasc-uhfffaoysa-m...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPDQT-27 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-(methylthio)-2-oxohexanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** csccccc(=o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** grugzhaoxopasc-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 175.222 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXNQT-4165]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-(methylthio)-2-oxohexanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=grugzhaoxopasc-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=175.222}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPDQT-27
- common-name:
- 6-(methylthio)-2-oxohexanoate
- smiles:
- csccccc(=o)c([o-])=o
- inchi-key:
- grugzhaoxopasc-uhfffaoysa-m
- molecular-weight:
- 175.222
