Difference between revisions of "CPDQT-27"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD == * common-name: ** pelargonidin-3-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([...")
(Created page with "Category:metabolite == Metabolite PHTYOSPHINGOSINE-1-P == * common-name: ** phytosphingosine 1-phosphate * smiles: ** ccccccccccccccc(o)c(c(cop([o-])(=o)[o-])[n+])o * inch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD ==
+
== Metabolite PHTYOSPHINGOSINE-1-P ==
 
* common-name:
 
* common-name:
** pelargonidin-3-o-β-d-glucoside
+
** phytosphingosine 1-phosphate
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
+
** ccccccccccccccc(o)c(c(cop([o-])(=o)[o-])[n+])o
 
* inchi-key:
 
* inchi-key:
** abvcubuixwjyse-gqupqbgvsa-m
+
** aygoskultisfcw-kszliroesa-m
 
* molecular-weight:
 
* molecular-weight:
** 431.375
+
** 396.483
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7828]]
+
* [[RXN-13729]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN3O-458]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pelargonidin-3-o-β-d-glucoside}}
+
{{#set: common-name=phytosphingosine 1-phosphate}}
{{#set: inchi-key=inchikey=abvcubuixwjyse-gqupqbgvsa-m}}
+
{{#set: inchi-key=inchikey=aygoskultisfcw-kszliroesa-m}}
{{#set: molecular-weight=431.375}}
+
{{#set: molecular-weight=396.483}}

Revision as of 13:08, 14 January 2021

Metabolite PHTYOSPHINGOSINE-1-P

  • common-name:
    • phytosphingosine 1-phosphate
  • smiles:
    • ccccccccccccccc(o)c(c(cop([o-])(=o)[o-])[n+])o
  • inchi-key:
    • aygoskultisfcw-kszliroesa-m
  • molecular-weight:
    • 396.483

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality