Difference between revisions of "CPDQT-36"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite O-PHOSPHO-L-HOMOSERINE == * common-name: ** o-phospho-l-homoserine * smiles: ** c(cop([o-])(=o)[o-])c([n+])c([o-])=o * inchi-key: ** fxdn...") |
(Created page with "Category:metabolite == Metabolite CPDQT-36 == * common-name: ** 3-[(3'-methylthio)propyl]malate * smiles: ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] * inchi-key: ** sqxviiopmysnc...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPDQT-36 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-[(3'-methylthio)propyl]malate |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sqxviiopmysncp-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 220.24 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-18208]] | |
− | * [[RXN- | + | * [[RXNQT-4165]] |
− | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-18208]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-[(3'-methylthio)propyl]malate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sqxviiopmysncp-uhfffaoysa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=220.24}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPDQT-36
- common-name:
- 3-[(3'-methylthio)propyl]malate
- smiles:
- c(c(cccsc)c(o)c(=o)[o-])(=o)[o-]
- inchi-key:
- sqxviiopmysncp-uhfffaoysa-l
- molecular-weight:
- 220.24
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(3'-methylthio)propyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.