Difference between revisions of "CPDQT-37"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21441 == * transcription-direction: ** negative * right-end-position: ** 389450 * left-end-position: ** 376377 * centisome-position: ** 62.80969...") |
(Created page with "Category:metabolite == Metabolite CPDQT-37 == * common-name: ** 3-[(4'-methylthio)butyl]malate * smiles: ** csccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** zizldvklmyvmnx-...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPDQT-37 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-[(4'-methylthio)butyl]malate |
| − | + | * smiles: | |
| − | * | + | ** csccccc(c(o)c(=o)[o-])c(=o)[o-] |
| − | + | * inchi-key: | |
| − | ** | + | ** zizldvklmyvmnx-uhfffaoysa-l |
| − | + | * molecular-weight: | |
| − | + | ** 234.267 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[RXN-18206]] | |
| − | + | * [[RXNQT-4168]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-18206]] |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=3-[(4'-methylthio)butyl]malate}} | |
| − | * | + | {{#set: inchi-key=inchikey=zizldvklmyvmnx-uhfffaoysa-l}} |
| − | + | {{#set: molecular-weight=234.267}} | |
| − | |||
| − | ** | ||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | * | ||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPDQT-37
- common-name:
- 3-[(4'-methylthio)butyl]malate
- smiles:
- csccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- zizldvklmyvmnx-uhfffaoysa-l
- molecular-weight:
- 234.267
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(4'-methylthio)butyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
