Difference between revisions of "CPDQT-39"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10615 RXN-10615] == * direction: ** left-to-right * common-name: ** aryl sulfotransferase ** su...") |
(Created page with "Category:metabolite == Metabolite CPDQT-39 == * common-name: ** 3-[(6'-methylthio)hexyl]malate * smiles: ** csccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** lqqzhlhcfscjc...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPDQT-39 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 3-[(6'-methylthio)hexyl]malate |
| − | + | * smiles: | |
| − | + | ** csccccccc(c(o)c(=o)[o-])c(=o)[o-] | |
| − | + | * inchi-key: | |
| − | + | ** lqqzhlhcfscjcu-uhfffaoysa-l | |
| − | * | + | * molecular-weight: |
| − | + | ** 262.32 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[RXN-18202]] | |
| − | + | * [[RXNQT-4174]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-18202]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=3-[(6'-methylthio)hexyl]malate}} | |
| − | + | {{#set: inchi-key=inchikey=lqqzhlhcfscjcu-uhfffaoysa-l}} | |
| − | + | {{#set: molecular-weight=262.32}} | |
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | ** | ||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | ** | ||
| − | |||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | == | ||
| − | * | ||
| − | |||
| − | == | ||
| − | |||
| − | {{#set: common-name= | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPDQT-39
- common-name:
- 3-[(6'-methylthio)hexyl]malate
- smiles:
- csccccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- lqqzhlhcfscjcu-uhfffaoysa-l
- molecular-weight:
- 262.32
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(6'-methylthio)hexyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
